About 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol
3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol (PubChem CID 69277375) has the molecular formula C17H30O2
and a molecular weight of 266.43 g/mol. Its IUPAC name is 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol.
Molecular Properties
| Compound Name | 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol |
| PubChem CID | 69277375 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol |
| SMILES | CC(C)(O)CCc1ccccc1.CCC(C)(O)CC |
| InChI | InChI=1S/C11H16O.C6H14O/c1-11(2,12)9-8-10-6-4-3-5-7-10;1-4-6(3,7)5-2/h3-7,12H,8-9H2,1-2H3;7H,4-5H2,1-3H3 |
| InChIKey | CSFIAOOWLOGWMD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol?
The IUPAC name of 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol (CID 69277375) is 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol.
What is the SMILES notation for 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol?
The canonical SMILES for 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol is CC(C)(O)CCc1ccccc1.CCC(C)(O)CC.
What is the InChIKey of 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol?
The InChIKey is CSFIAOOWLOGWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C6H14O/c1-11(2,12)9-8-10-6-4-3-5-7-10;1-4-6(3,7)5-2/h3-7,12H,8-9H2,1-2H3;7H,4-5H2,1-3H3.
What are the key properties of 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol?
3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol has a molecular weight of 266.43 g/mol, XLogP of 3.95, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentan-3-ol;2-methyl-4-phenylbutan-2-ol is sourced from PubChem (CID 69277375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).