C24H31F3N6O3 — CID 69277692
5-nitro-2-N-[phenyl(trifluoromethoxy)methyl]-4-N-[(4-piperidin-1-ylcyclohexyl)methyl]pyrimidine-2,4-diamine (PubChem CID 69277692) has the molecular formula C24H31F3N6O3 and a molecular weight of 508.55 g/mol. Its IUPAC name is 5-nitro-2-N-[phenyl(trifluoromethoxy)methyl]-4-N-[(4-piperidin-1-ylcyclohexyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[phenyl(trifluoromethoxy)methyl]-4-N-[(4-piperidin-1-ylcyclohexyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 69277692 |
| Molecular Formula | C24H31F3N6O3 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 5-nitro-2-N-[phenyl(trifluoromethoxy)methyl]-4-N-[(4-piperidin-1-ylcyclohexyl)methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NC(OC(F)(F)F)c2ccccc2)nc1NCC1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C24H31F3N6O3/c25-24(26,27)36-22(18-7-3-1-4-8-18)31-23-29-16-20(33(34)35)21(30-23)28-15-17-9-11-19(12-10-17)32-13-5-2-6-14-32/h1,3-4,7-8,16-17,19,22H,2,5-6,9-15H2,(H2,28,29,30,31) |
| InChIKey | OVCMXOYMHJIBGS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|