C21H27N2O2S+ — CID 69278285
[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(5-methyl-2-thiophen-3-ylphenyl)carbamate (PubChem CID 69278285) has the molecular formula C21H27N2O2S+ and a molecular weight of 371.53 g/mol. Its IUPAC name is [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(5-methyl-2-thiophen-3-ylphenyl)carbamate.
| Compound Name | [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(5-methyl-2-thiophen-3-ylphenyl)carbamate |
|---|---|
| PubChem CID | 69278285 |
| Molecular Formula | C21H27N2O2S+ |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-(5-methyl-2-thiophen-3-ylphenyl)carbamate |
| SMILES | Cc1ccc(-c2ccsc2)c(NC(=O)OC2C[C@H]3CC[C@@H](C2)[N+]3(C)C)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-14-4-7-19(15-8-9-26-13-15)20(10-14)22-21(24)25-18-11-16-5-6-17(12-18)23(16,2)3/h4,7-10,13,16-18H,5-6,11-12H2,1-3H3/p+1/t16-,17+,18? |
| InChIKey | KPIMXPQEGXCERH-JWTNVVGKSA-O |
| XLogP | 5.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|