About methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate
methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate (PubChem CID 69278317) has the molecular formula C25H26N2O3S
and a molecular weight of 434.56 g/mol. Its IUPAC name is methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate |
| PubChem CID | 69278317 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate |
| SMILES | COC(=O)c1ccccc1SC1c2ccc(N(C)C)cc2Oc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C25H26N2O3S/c1-26(2)16-10-12-18-21(14-16)30-22-15-17(27(3)4)11-13-19(22)24(18)31-23-9-7-6-8-20(23)25(28)29-5/h6-15,24H,1-5H3 |
| InChIKey | VJWUKLSTGZWTBZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate?
The IUPAC name of methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate (CID 69278317) is methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate.
What is the SMILES notation for methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate?
The canonical SMILES for methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate is COC(=O)c1ccccc1SC1c2ccc(N(C)C)cc2Oc2cc(N(C)C)ccc21.
What is the InChIKey of methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate?
The InChIKey is VJWUKLSTGZWTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O3S/c1-26(2)16-10-12-18-21(14-16)30-22-15-17(27(3)4)11-13-19(22)24(18)31-23-9-7-6-8-20(23)25(28)29-5/h6-15,24H,1-5H3.
What are the key properties of methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate?
methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate has a molecular weight of 434.56 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[3,6-bis(dimethylamino)-9H-xanthen-9-yl]sulfanyl]benzoate is sourced from PubChem (CID 69278317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).