C14H23NO — CID 69278397
N-[(2S,7S)-1,2-dimethyl-2-adamantyl]acetamide (PubChem CID 69278397) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-[(2S,7S)-1,2-dimethyl-2-adamantyl]acetamide.
| Compound Name | N-[(2S,7S)-1,2-dimethyl-2-adamantyl]acetamide |
|---|---|
| PubChem CID | 69278397 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-[(2S,7S)-1,2-dimethyl-2-adamantyl]acetamide |
| SMILES | CC(=O)N[C@@]1(C)C2CC3C[C@@H](C2)CC1(C)C3 |
| InChI | InChI=1S/C14H23NO/c1-9(16)15-14(3)12-5-10-4-11(6-12)8-13(14,2)7-10/h10-12H,4-8H2,1-3H3,(H,15,16)/t10-,11?,12?,13?,14-/m0/s1 |
| InChIKey | HIVOGERXEDLJSZ-KFKLUBFYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |