C23H19ClF2N4O6 — CID 69278454
benzyl 1-(1-amino-3-ethoxy-1,3-dioxopropan-2-yl)-5-[(2-chloro-4,5-difluorobenzoyl)amino]pyrazole-3-carboxylate (PubChem CID 69278454) has the molecular formula C23H19ClF2N4O6 and a molecular weight of 520.88 g/mol. Its IUPAC name is benzyl 1-(1-amino-3-ethoxy-1,3-dioxopropan-2-yl)-5-[(2-chloro-4,5-difluorobenzoyl)amino]pyrazole-3-carboxylate.
| Compound Name | benzyl 1-(1-amino-3-ethoxy-1,3-dioxopropan-2-yl)-5-[(2-chloro-4,5-difluorobenzoyl)amino]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 69278454 |
| Molecular Formula | C23H19ClF2N4O6 |
| Molecular Weight | 520.88 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | benzyl 1-(1-amino-3-ethoxy-1,3-dioxopropan-2-yl)-5-[(2-chloro-4,5-difluorobenzoyl)amino]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C(C(N)=O)n1nc(C(=O)OCc2ccccc2)cc1NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C23H19ClF2N4O6/c1-2-35-23(34)19(20(27)31)30-18(28-21(32)13-8-15(25)16(26)9-14(13)24)10-17(29-30)22(33)36-11-12-6-4-3-5-7-12/h3-10,19H,2,11H2,1H3,(H2,27,31)(H,28,32) |
| InChIKey | QVHROTHMYMWXFO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|