About (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride
(2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride (PubChem CID 69278478) has the molecular formula C9H16Cl2N2O
and a molecular weight of 239.15 g/mol. Its IUPAC name is (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride |
| PubChem CID | 69278478 |
| Molecular Formula | C9H16Cl2N2O |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride |
| SMILES | COc1nc(C)cc(C)c1CN.Cl.Cl |
| InChI | InChI=1S/C9H14N2O.2ClH/c1-6-4-7(2)11-9(12-3)8(6)5-10;;/h4H,5,10H2,1-3H3;2*1H |
| InChIKey | MWJOQOGXWJWTMI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride?
The IUPAC name of (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride (CID 69278478) is (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride.
What is the SMILES notation for (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride?
The canonical SMILES for (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride is COc1nc(C)cc(C)c1CN.Cl.Cl.
What is the InChIKey of (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride?
The InChIKey is MWJOQOGXWJWTMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O.2ClH/c1-6-4-7(2)11-9(12-3)8(6)5-10;;/h4H,5,10H2,1-3H3;2*1H.
What are the key properties of (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride?
(2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride has a molecular weight of 239.15 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4,6-dimethyl-3-pyridinyl)methanamine;dihydrochloride is sourced from PubChem (CID 69278478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).