About benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate
benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate (PubChem CID 69278703) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate.
Molecular Properties
| Compound Name | benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate |
| PubChem CID | 69278703 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate |
| SMILES | O=C(OCc1ccccc1)ON1CCCC2(CC1)CC(c1ccccc1)=NO2 |
| InChI | InChI=1S/C22H24N2O4/c25-21(26-17-18-8-3-1-4-9-18)27-24-14-7-12-22(13-15-24)16-20(23-28-22)19-10-5-2-6-11-19/h1-6,8-11H,7,12-17H2 |
| InChIKey | SJVJFOCIKKBWDC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate?
The IUPAC name of benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate (CID 69278703) is benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate.
What is the SMILES notation for benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate?
The canonical SMILES for benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate is O=C(OCc1ccccc1)ON1CCCC2(CC1)CC(c1ccccc1)=NO2.
What is the InChIKey of benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate?
The InChIKey is SJVJFOCIKKBWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c25-21(26-17-18-8-3-1-4-9-18)27-24-14-7-12-22(13-15-24)16-20(23-28-22)19-10-5-2-6-11-19/h1-6,8-11H,7,12-17H2.
What are the key properties of benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate?
benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate has a molecular weight of 380.44 g/mol, XLogP of 4.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-2-en-9-yl) carbonate is sourced from PubChem (CID 69278703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).