C21H18Cl2FN7O — CID 69278913
7-[5-[(2,3-dichloro-6-fluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 69278913) has the molecular formula C21H18Cl2FN7O and a molecular weight of 474.33 g/mol. Its IUPAC name is 7-[5-[(2,3-dichloro-6-fluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 7-[5-[(2,3-dichloro-6-fluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 69278913 |
| Molecular Formula | C21H18Cl2FN7O |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 7-[5-[(2,3-dichloro-6-fluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | Nc1nc(N2CC3CC2CN3Cc2c(F)ccc(Cl)c2Cl)cc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C21H18Cl2FN7O/c22-14-3-4-15(24)13(19(14)23)10-29-8-12-6-11(29)9-30(12)17-7-18-26-20(16-2-1-5-32-16)28-31(18)21(25)27-17/h1-5,7,11-12H,6,8-10H2,(H2,25,27) |
| InChIKey | YAKNSTBPAXLCMU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|