C21H19F2N7O — CID 69278928
7-[3-[(2,6-difluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 69278928) has the molecular formula C21H19F2N7O and a molecular weight of 423.43 g/mol. Its IUPAC name is 7-[3-[(2,6-difluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 7-[3-[(2,6-difluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 69278928 |
| Molecular Formula | C21H19F2N7O |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 7-[3-[(2,6-difluorophenyl)methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | Nc1nc(N2C3CNC(C3)C2Cc2c(F)cccc2F)cc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C21H19F2N7O/c22-13-3-1-4-14(23)12(13)8-16-15-7-11(10-25-15)29(16)18-9-19-26-20(17-5-2-6-31-17)28-30(19)21(24)27-18/h1-6,9,11,15-16,25H,7-8,10H2,(H2,24,27) |
| InChIKey | LIAULCMSUTVDMM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |