C26H34O8 — CID 69279595
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[2-[(4-methoxyphenyl)methyl]phenyl]oxan-2-yl] hexanoate (PubChem CID 69279595) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[2-[(4-methoxyphenyl)methyl]phenyl]oxan-2-yl] hexanoate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[2-[(4-methoxyphenyl)methyl]phenyl]oxan-2-yl] hexanoate |
|---|---|
| PubChem CID | 69279595 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[2-[(4-methoxyphenyl)methyl]phenyl]oxan-2-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@]1(O)c1ccccc1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34O8/c1-3-4-5-10-22(28)34-25-26(31,24(30)23(29)21(16-27)33-25)20-9-7-6-8-18(20)15-17-11-13-19(32-2)14-12-17/h6-9,11-14,21,23-25,27,29-31H,3-5,10,15-16H2,1-2H3/t21-,23-,24+,25+,26-/m1/s1 |
| InChIKey | YSIFNDROZMSVDW-BMLQBVLXSA-N |
| XLogP | 2.04 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|