C20H24N4O — CID 69279612
1-benzyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)azepan-4-ol (PubChem CID 69279612) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-benzyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)azepan-4-ol.
| Compound Name | 1-benzyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)azepan-4-ol |
|---|---|
| PubChem CID | 69279612 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-benzyl-4-(1-methylimidazo[4,5-b]pyridin-2-yl)azepan-4-ol |
| SMILES | Cn1c(C2(O)CCCN(Cc3ccccc3)CC2)nc2ncccc21 |
| InChI | InChI=1S/C20H24N4O/c1-23-17-9-5-12-21-18(17)22-19(23)20(25)10-6-13-24(14-11-20)15-16-7-3-2-4-8-16/h2-5,7-9,12,25H,6,10-11,13-15H2,1H3 |
| InChIKey | HLBRWGLVPVABQS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |