About 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol
6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol (PubChem CID 69279966) has the molecular formula C18H17Cl2N3OS
and a molecular weight of 394.33 g/mol. Its IUPAC name is 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol.
Molecular Properties
| Compound Name | 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol |
| PubChem CID | 69279966 |
| Molecular Formula | C18H17Cl2N3OS |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol |
| SMILES | Oc1cc(N2CCN(Cc3cccc(Cl)c3Cl)CC2)cc2scnc12 |
| InChI | InChI=1S/C18H17Cl2N3OS/c19-14-3-1-2-12(17(14)20)10-22-4-6-23(7-5-22)13-8-15(24)18-16(9-13)25-11-21-18/h1-3,8-9,11,24H,4-7,10H2 |
| InChIKey | YTPFTAIRGSPXFZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol?
The IUPAC name of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol (CID 69279966) is 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol.
What is the SMILES notation for 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol?
The canonical SMILES for 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol is Oc1cc(N2CCN(Cc3cccc(Cl)c3Cl)CC2)cc2scnc12.
What is the InChIKey of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol?
The InChIKey is YTPFTAIRGSPXFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N3OS/c19-14-3-1-2-12(17(14)20)10-22-4-6-23(7-5-22)13-8-15(24)18-16(9-13)25-11-21-18/h1-3,8-9,11,24H,4-7,10H2.
What are the key properties of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol?
6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol has a molecular weight of 394.33 g/mol, XLogP of 4.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazol-4-ol is sourced from PubChem (CID 69279966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).