C8H6N3O2S2- — CID 6927999
2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 6927999) has the molecular formula C8H6N3O2S2- and a molecular weight of 240.29 g/mol. Its IUPAC name is 2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | 2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 6927999 |
| Molecular Formula | C8H6N3O2S2- |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 2-[(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | O=C([O-])CSc1n[nH]c(-c2cccs2)n1 |
| InChI | InChI=1S/C8H7N3O2S2/c12-6(13)4-15-8-9-7(10-11-8)5-2-1-3-14-5/h1-3H,4H2,(H,12,13)(H,9,10,11)/p-1 |
| InChIKey | MAZQOFWUNXOPKQ-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |