About CID 69280188
CID 69280188 (PubChem CID 69280188) has the molecular formula C10H8KO
and a molecular weight of 183.27 g/mol.
Molecular Properties
| Compound Name | CID 69280188 |
| PubChem CID | 69280188 |
| Molecular Formula | C10H8KO |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | — |
| SMILES | Oc1ccc2ccccc2c1.[K] |
| InChI | InChI=1S/C10H8O.K/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11H; |
| InChIKey | RJJQNHWDBCGYCD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 69280188 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69280188?
The IUPAC name of CID 69280188 (CID 69280188) is not available.
What is the SMILES notation for CID 69280188?
The canonical SMILES for CID 69280188 is Oc1ccc2ccccc2c1.[K].
What is the InChIKey of CID 69280188?
The InChIKey is RJJQNHWDBCGYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.K/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11H;.
What are the key properties of CID 69280188?
CID 69280188 has a molecular weight of 183.27 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69280188 is sourced from PubChem (CID 69280188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).