About 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole
5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole (PubChem CID 69280234) has the molecular formula C12H12Cl2N2
and a molecular weight of 255.15 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole |
| PubChem CID | 69280234 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole |
| SMILES | Cc1c(-c2ccc(Cl)cc2)nn(C)c1CCl |
| InChI | InChI=1S/C12H12Cl2N2/c1-8-11(7-13)16(2)15-12(8)9-3-5-10(14)6-4-9/h3-6H,7H2,1-2H3 |
| InChIKey | GKYKZXJZKSOFBR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole?
The IUPAC name of 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole (CID 69280234) is 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole.
What is the SMILES notation for 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole?
The canonical SMILES for 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole is Cc1c(-c2ccc(Cl)cc2)nn(C)c1CCl.
What is the InChIKey of 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole?
The InChIKey is GKYKZXJZKSOFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2/c1-8-11(7-13)16(2)15-12(8)9-3-5-10(14)6-4-9/h3-6H,7H2,1-2H3.
What are the key properties of 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole?
5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole has a molecular weight of 255.15 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-3-(4-chlorophenyl)-1,4-dimethylpyrazole is sourced from PubChem (CID 69280234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).