C28H24FN5O5 — CID 69280527
N-[4-[3-(butanoylamino)phenyl]-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-pyridinyl]-1,2-oxazole-5-carboxamide (PubChem CID 69280527) has the molecular formula C28H24FN5O5 and a molecular weight of 529.53 g/mol. Its IUPAC name is N-[4-[3-(butanoylamino)phenyl]-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-pyridinyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-[3-(butanoylamino)phenyl]-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-pyridinyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 69280527 |
| Molecular Formula | C28H24FN5O5 |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-[4-[3-(butanoylamino)phenyl]-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-pyridinyl]-1,2-oxazole-5-carboxamide |
| SMILES | CCCC(=O)Nc1cccc(-c2cc(-c3ccc(F)cc3OCOC)nc(NC(=O)c3ccno3)c2C#N)c1 |
| InChI | InChI=1S/C28H24FN5O5/c1-3-5-26(35)32-19-7-4-6-17(12-19)21-14-23(20-9-8-18(29)13-25(20)38-16-37-2)33-27(22(21)15-30)34-28(36)24-10-11-31-39-24/h4,6-14H,3,5,16H2,1-2H3,(H,32,35)(H,33,34,36) |
| InChIKey | IPWVGPZNUDOGBE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|