C26H32F2N2O5S — CID 69280756
(3aR,5S,6S,7R,7aR)-5-(1,1-difluoroethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine (PubChem CID 69280756) has the molecular formula C26H32F2N2O5S and a molecular weight of 522.61 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-5-(1,1-difluoroethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine.
| Compound Name | (3aR,5S,6S,7R,7aR)-5-(1,1-difluoroethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 69280756 |
| Molecular Formula | C26H32F2N2O5S |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-5-(1,1-difluoroethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
| SMILES | COc1ccc(CO[C@@H]2[C@H]3N=C(N(C)C)S[C@H]3O[C@H](C(C)(F)F)[C@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H32F2N2O5S/c1-26(27,28)23-22(34-15-17-8-12-19(32-5)13-9-17)21(20-24(35-23)36-25(29-20)30(2)3)33-14-16-6-10-18(31-4)11-7-16/h6-13,20-24H,14-15H2,1-5H3/t20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | ALBCFKSIVMZQNJ-URYYLNOGSA-N |
| XLogP | 4.59 |
| TPSA | 61.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |