C13H21FN2O3S — CID 69280856
(1R,2R,6R,8S,9S)-8-[(1S)-1-fluoroethyl]-N,N,11,11-tetramethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine (PubChem CID 69280856) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is (1R,2R,6R,8S,9S)-8-[(1S)-1-fluoroethyl]-N,N,11,11-tetramethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine.
| Compound Name | (1R,2R,6R,8S,9S)-8-[(1S)-1-fluoroethyl]-N,N,11,11-tetramethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine |
|---|---|
| PubChem CID | 69280856 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (1R,2R,6R,8S,9S)-8-[(1S)-1-fluoroethyl]-N,N,11,11-tetramethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine |
| SMILES | C[C@H](F)[C@H]1O[C@@H]2SC(N(C)C)=N[C@@H]2[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H21FN2O3S/c1-6(14)8-10-9(18-13(2,3)19-10)7-11(17-8)20-12(15-7)16(4)5/h6-11H,1-5H3/t6-,7+,8+,9+,10+,11+/m0/s1 |
| InChIKey | AHTNBLGITOXLQP-FHMMKVKMSA-N |
| XLogP | 1.62 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |