About 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole
4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole (PubChem CID 69280935) has the molecular formula C13H17BClNO5
and a molecular weight of 313.55 g/mol. Its IUPAC name is 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole |
| PubChem CID | 69280935 |
| Molecular Formula | C13H17BClNO5 |
| Molecular Weight | 313.55 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole |
| SMILES | CCCCCOc1ccc(Cl)c2c1B(O)OC2C[N+](=O)[O-] |
| InChI | InChI=1S/C13H17BClNO5/c1-2-3-4-7-20-10-6-5-9(15)12-11(8-16(18)19)21-14(17)13(10)12/h5-6,11,17H,2-4,7-8H2,1H3 |
| InChIKey | OMMNZOZCEOVBOF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole?
The IUPAC name of 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole (CID 69280935) is 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole.
What is the SMILES notation for 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole?
The canonical SMILES for 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole is CCCCCOc1ccc(Cl)c2c1B(O)OC2C[N+](=O)[O-].
What is the InChIKey of 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole?
The InChIKey is OMMNZOZCEOVBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BClNO5/c1-2-3-4-7-20-10-6-5-9(15)12-11(8-16(18)19)21-14(17)13(10)12/h5-6,11,17H,2-4,7-8H2,1H3.
What are the key properties of 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole?
4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole has a molecular weight of 313.55 g/mol, XLogP of 1.94, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-hydroxy-3-(nitromethyl)-7-pentoxy-3H-2,1-benzoxaborole is sourced from PubChem (CID 69280935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).