C19H32N2O3 — CID 69281624
tert-butyl (4S,5R)-4-[2-(4-aminocyclohexa-1,5-dien-1-yl)ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 69281624) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[2-(4-aminocyclohexa-1,5-dien-1-yl)ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[2-(4-aminocyclohexa-1,5-dien-1-yl)ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 69281624 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | tert-butyl (4S,5R)-4-[2-(4-aminocyclohexa-1,5-dien-1-yl)ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CCC1=CCC(N)C=C1 |
| InChI | InChI=1S/C19H32N2O3/c1-13-16(12-9-14-7-10-15(20)11-8-14)21(19(5,6)23-13)17(22)24-18(2,3)4/h7-8,10,13,15-16H,9,11-12,20H2,1-6H3/t13-,15?,16+/m1/s1 |
| InChIKey | MSXGHPDKJMWAKT-BXCKNWRKSA-N |
| XLogP | 3.74 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |