C13H19N — CID 69281697
(7S)-7-tert-butyl-5,6,7,8-tetrahydroquinoline (PubChem CID 69281697) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (7S)-7-tert-butyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | (7S)-7-tert-butyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 69281697 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (7S)-7-tert-butyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CC(C)(C)[C@H]1CCc2cccnc2C1 |
| InChI | InChI=1S/C13H19N/c1-13(2,3)11-7-6-10-5-4-8-14-12(10)9-11/h4-5,8,11H,6-7,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | YWVVGQBJOZRWFD-NSHDSACASA-N |
| XLogP | 3.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |