C46H38N4O6 — CID 69281965
(15-acetyloxy-23,29-dimethyl-19,32-dioxo-4,5-diphenyl-3,6,18,20-tetrazaoctacyclo[20.7.1.13,6.18,12.04,20.05,18.026,30.016,31]dotriaconta-1(29),8,10,12(31),13,15,22,24,26(30),27-decaen-9-yl) acetate (PubChem CID 69281965) has the molecular formula C46H38N4O6 and a molecular weight of 742.83 g/mol. Its IUPAC name is (15-acetyloxy-23,29-dimethyl-19,32-dioxo-4,5-diphenyl-3,6,18,20-tetrazaoctacyclo[20.7.1.13,6.18,12.04,20.05,18.026,30.016,31]dotriaconta-1(29),8,10,12(31),13,15,22,24,26(30),27-decaen-9-yl) acetate.
| Compound Name | (15-acetyloxy-23,29-dimethyl-19,32-dioxo-4,5-diphenyl-3,6,18,20-tetrazaoctacyclo[20.7.1.13,6.18,12.04,20.05,18.026,30.016,31]dotriaconta-1(29),8,10,12(31),13,15,22,24,26(30),27-decaen-9-yl) acetate |
|---|---|
| PubChem CID | 69281965 |
| Molecular Formula | C46H38N4O6 |
| Molecular Weight | 742.83 g/mol |
| Exact Mass | 742.28 |
| IUPAC Name | (15-acetyloxy-23,29-dimethyl-19,32-dioxo-4,5-diphenyl-3,6,18,20-tetrazaoctacyclo[20.7.1.13,6.18,12.04,20.05,18.026,30.016,31]dotriaconta-1(29),8,10,12(31),13,15,22,24,26(30),27-decaen-9-yl) acetate |
| SMILES | CC(=O)Oc1ccc2ccc(OC(C)=O)c3c2c1CN1C(=O)N2Cc4c(C)ccc5ccc(C)c(c45)CN4C(=O)N(C3)C1(c1ccccc1)C24c1ccccc1 |
| InChI | InChI=1S/C46H38N4O6/c1-27-15-17-31-18-16-28(2)36-24-48-44(54)50-26-38-40(56-30(4)52)22-20-32-19-21-39(55-29(3)51)37(42(32)38)25-49-43(53)47(23-35(27)41(31)36)45(48,33-11-7-5-8-12-33)46(49,50)34-13-9-6-10-14-34/h5-22H,23-26H2,1-4H3 |
| InChIKey | PBKYYMHXIYIOJT-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.83 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|