C25H21NO2 — CID 69282051
(4S,5S)-5-(3,4-dimethylphenyl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 69282051) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (4S,5S)-5-(3,4-dimethylphenyl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-(3,4-dimethylphenyl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69282051 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (4S,5S)-5-(3,4-dimethylphenyl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc([C@@H]2OC(=O)N[C@H]2c2cccc(C#Cc3ccccc3)c2)cc1C |
| InChI | InChI=1S/C25H21NO2/c1-17-11-14-22(15-18(17)2)24-23(26-25(27)28-24)21-10-6-9-20(16-21)13-12-19-7-4-3-5-8-19/h3-11,14-16,23-24H,1-2H3,(H,26,27)/t23-,24-/m0/s1 |
| InChIKey | SODCPOYOEMBPAD-ZEQRLZLVSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|