C25H17N3O3 — CID 69282108
(4S,5R)-4-[3-(2-phenylethynyl)phenyl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 69282108) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is (4S,5R)-4-[3-(2-phenylethynyl)phenyl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-[3-(2-phenylethynyl)phenyl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69282108 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (4S,5R)-4-[3-(2-phenylethynyl)phenyl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](c2cccc(C#Cc3ccccc3)c2)[C@H](c2nc(-c3ccccc3)no2)O1 |
| InChI | InChI=1S/C25H17N3O3/c29-25-26-21(20-13-7-10-18(16-20)15-14-17-8-3-1-4-9-17)22(30-25)24-27-23(28-31-24)19-11-5-2-6-12-19/h1-13,16,21-22H,(H,26,29)/t21-,22+/m0/s1 |
| InChIKey | YQDAAAUKIBQSJP-FCHUYYIVSA-N |
| XLogP | 4.66 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|