C20H15N3O3 — CID 69282124
(4S,5R)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 69282124) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is (4S,5R)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69282124 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (4S,5R)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[3-(2-phenylethynyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1noc([C@@H]2OC(=O)N[C@H]2c2cccc(C#Cc3ccccc3)c2)n1 |
| InChI | InChI=1S/C20H15N3O3/c1-13-21-19(26-23-13)18-17(22-20(24)25-18)16-9-5-8-15(12-16)11-10-14-6-3-2-4-7-14/h2-9,12,17-18H,1H3,(H,22,24)/t17-,18+/m0/s1 |
| InChIKey | NUEWFMKSKAWYBM-ZWKOTPCHSA-N |
| XLogP | 3.30 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|