About (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one
(4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 69282181) has the molecular formula C20H15FN2O2
and a molecular weight of 334.35 g/mol. Its IUPAC name is (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 69282181 |
| Molecular Formula | C20H15FN2O2 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2nc(-c3ccccc3)ccc2F)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C20H15FN2O2/c21-15-11-12-16(13-7-3-1-4-8-13)22-17(15)18-19(25-20(24)23-18)14-9-5-2-6-10-14/h1-12,18-19H,(H,23,24)/t18-,19-/m1/s1 |
| InChIKey | JXVZSNZTXZYVNY-RTBURBONSA-N |
| XLogP | 4.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one (CID 69282181) is (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one is O=C1N[C@H](c2nc(-c3ccccc3)ccc2F)[C@@H](c2ccccc2)O1.
What is the InChIKey of (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one?
The InChIKey is JXVZSNZTXZYVNY-RTBURBONSA-N. The full InChI is InChI=1S/C20H15FN2O2/c21-15-11-12-16(13-7-3-1-4-8-13)22-17(15)18-19(25-20(24)23-18)14-9-5-2-6-10-14/h1-12,18-19H,(H,23,24)/t18-,19-/m1/s1.
What are the key properties of (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one?
(4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one has a molecular weight of 334.35 g/mol, XLogP of 4.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4-(3-fluoro-6-phenyl-2-pyridinyl)-5-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 69282181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).