C18H10O15P+ — CID 69282312
oxo-bis(2,3,5-tricarboxyphenoxy)phosphanium (PubChem CID 69282312) has the molecular formula C18H10O15P+ and a molecular weight of 497.24 g/mol. Its IUPAC name is oxo-bis(2,3,5-tricarboxyphenoxy)phosphanium.
| Compound Name | oxo-bis(2,3,5-tricarboxyphenoxy)phosphanium |
|---|---|
| PubChem CID | 69282312 |
| Molecular Formula | C18H10O15P+ |
| Molecular Weight | 497.24 g/mol |
| Exact Mass | 496.98 |
| IUPAC Name | oxo-bis(2,3,5-tricarboxyphenoxy)phosphanium |
| SMILES | O=C(O)c1cc(O[P+](=O)Oc2cc(C(=O)O)cc(C(=O)O)c2C(=O)O)c(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H9O15P/c19-13(20)5-1-7(15(23)24)11(17(27)28)9(3-5)32-34(31)33-10-4-6(14(21)22)2-8(16(25)26)12(10)18(29)30/h1-4H,(H5-,19,20,21,22,23,24,25,26,27,28,29,30)/p+1 |
| InChIKey | DQUXRMNZAJEIBS-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 259.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|