C15H12O6 — CID 69282430
5-phenylcyclohexa-2,4-diene-1,1,3-tricarboxylic acid (PubChem CID 69282430) has the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. Its IUPAC name is 5-phenylcyclohexa-2,4-diene-1,1,3-tricarboxylic acid.
| Compound Name | 5-phenylcyclohexa-2,4-diene-1,1,3-tricarboxylic acid |
|---|---|
| PubChem CID | 69282430 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-phenylcyclohexa-2,4-diene-1,1,3-tricarboxylic acid |
| SMILES | O=C(O)C1=CC(C(=O)O)(C(=O)O)CC(c2ccccc2)=C1 |
| InChI | InChI=1S/C15H12O6/c16-12(17)11-6-10(9-4-2-1-3-5-9)7-15(8-11,13(18)19)14(20)21/h1-6,8H,7H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | IPTPTTQUHYBGQQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|