C14H21N — CID 69282467
9-ethyl-1,2,3,4,4a,4b,8a,9a-octahydrocarbazole (PubChem CID 69282467) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 9-ethyl-1,2,3,4,4a,4b,8a,9a-octahydrocarbazole.
| Compound Name | 9-ethyl-1,2,3,4,4a,4b,8a,9a-octahydrocarbazole |
|---|---|
| PubChem CID | 69282467 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 9-ethyl-1,2,3,4,4a,4b,8a,9a-octahydrocarbazole |
| SMILES | CCN1C2C=CC=CC2C2CCCCC21 |
| InChI | InChI=1S/C14H21N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3,5,7,9,11-14H,2,4,6,8,10H2,1H3 |
| InChIKey | QPXMYPNVOAAZIK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |