C14H23N — CID 69282469
9-ethyl-1,2,3,4,4a,4b,5,6,7,9a-decahydrocarbazole (PubChem CID 69282469) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 9-ethyl-1,2,3,4,4a,4b,5,6,7,9a-decahydrocarbazole.
| Compound Name | 9-ethyl-1,2,3,4,4a,4b,5,6,7,9a-decahydrocarbazole |
|---|---|
| PubChem CID | 69282469 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 9-ethyl-1,2,3,4,4a,4b,5,6,7,9a-decahydrocarbazole |
| SMILES | CCN1C2=CCCCC2C2CCCCC21 |
| InChI | InChI=1S/C14H23N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h9,11-12,14H,2-8,10H2,1H3 |
| InChIKey | IXLBSJYSIZSCPW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |