About 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one
1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one (PubChem CID 69283365) has the molecular formula C19H19Cl2N3O
and a molecular weight of 376.29 g/mol. Its IUPAC name is 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one.
Molecular Properties
| Compound Name | 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one |
| PubChem CID | 69283365 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one |
| SMILES | O=C(CN1CCNCC1)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H19Cl2N3O/c20-13-1-3-18-16(9-13)17-10-14(21)2-4-19(17)24(18)12-15(25)11-23-7-5-22-6-8-23/h1-4,9-10,22H,5-8,11-12H2 |
| InChIKey | YGWVXXVXLSXJRS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one?
The IUPAC name of 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one (CID 69283365) is 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one.
What is the SMILES notation for 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one?
The canonical SMILES for 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one is O=C(CN1CCNCC1)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21.
What is the InChIKey of 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one?
The InChIKey is YGWVXXVXLSXJRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2N3O/c20-13-1-3-18-16(9-13)17-10-14(21)2-4-19(17)24(18)12-15(25)11-23-7-5-22-6-8-23/h1-4,9-10,22H,5-8,11-12H2.
What are the key properties of 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one?
1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one has a molecular weight of 376.29 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dichlorocarbazol-9-yl)-3-piperazin-1-ylpropan-2-one is sourced from PubChem (CID 69283365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).