About 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine
5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine (PubChem CID 69283620) has the molecular formula C12H19FN2O
and a molecular weight of 226.29 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine.
Molecular Properties
| Compound Name | 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine |
| PubChem CID | 69283620 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine |
| SMILES | NCCCC(N)COCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H19FN2O/c13-11-5-3-10(4-6-11)8-16-9-12(15)2-1-7-14/h3-6,12H,1-2,7-9,14-15H2 |
| InChIKey | COFYKOURBSTIMS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine?
The IUPAC name of 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine (CID 69283620) is 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine.
What is the SMILES notation for 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine?
The canonical SMILES for 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine is NCCCC(N)COCc1ccc(F)cc1.
What is the InChIKey of 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine?
The InChIKey is COFYKOURBSTIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FN2O/c13-11-5-3-10(4-6-11)8-16-9-12(15)2-1-7-14/h3-6,12H,1-2,7-9,14-15H2.
What are the key properties of 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine?
5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine has a molecular weight of 226.29 g/mol, XLogP of 1.41, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-fluorophenyl)methoxy]pentane-1,4-diamine is sourced from PubChem (CID 69283620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).