C33H31N7O3S — CID 69283872
N-[4-[4-amino-7-[(E)-3-(3-imidazol-1-ylpropylamino)-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide (PubChem CID 69283872) has the molecular formula C33H31N7O3S and a molecular weight of 605.72 g/mol. Its IUPAC name is N-[4-[4-amino-7-[(E)-3-(3-imidazol-1-ylpropylamino)-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[4-[4-amino-7-[(E)-3-(3-imidazol-1-ylpropylamino)-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 69283872 |
| Molecular Formula | C33H31N7O3S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | N-[4-[4-amino-7-[(E)-3-(3-imidazol-1-ylpropylamino)-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide |
| SMILES | COc1cc(-c2csc3c(/C=C/C(=O)NCCCn4ccnc4)cnc(N)c23)ccc1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C33H31N7O3S/c1-39-26-7-4-3-6-22(26)16-27(39)33(42)38-25-10-8-21(17-28(25)43-2)24-19-44-31-23(18-37-32(34)30(24)31)9-11-29(41)36-12-5-14-40-15-13-35-20-40/h3-4,6-11,13,15-20H,5,12,14H2,1-2H3,(H2,34,37)(H,36,41)(H,38,42)/b11-9+ |
| InChIKey | WTTOERYDEZXNSQ-PKNBQFBNSA-N |
| XLogP | 5.71 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|