C16H28N2 — CID 69284078
5-cyclonon-5-en-1-yl-2,3,4,6,7,8-hexahydro-1,5-diazonine (PubChem CID 69284078) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 5-cyclonon-5-en-1-yl-2,3,4,6,7,8-hexahydro-1,5-diazonine.
| Compound Name | 5-cyclonon-5-en-1-yl-2,3,4,6,7,8-hexahydro-1,5-diazonine |
|---|---|
| PubChem CID | 69284078 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 5-cyclonon-5-en-1-yl-2,3,4,6,7,8-hexahydro-1,5-diazonine |
| SMILES | C1=CCCCC(N2CCC/C=N\CCC2)CCC1 |
| InChI | InChI=1S/C16H28N2/c1-2-4-6-11-16(10-5-3-1)18-14-8-7-12-17-13-9-15-18/h1-2,12,16H,3-11,13-15H2/b2-1?,17-12- |
| InChIKey | GHEKCUYYNSZXMI-PSJQZTDXSA-N |
| XLogP | 3.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|