C15H19NO7 — CID 69284149
[(2R,3R,4S,5S,6R)-6-carbamoyl-3,5-dihydroxy-4-phenylmethoxyoxan-2-yl] acetate (PubChem CID 69284149) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-6-carbamoyl-3,5-dihydroxy-4-phenylmethoxyoxan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-6-carbamoyl-3,5-dihydroxy-4-phenylmethoxyoxan-2-yl] acetate |
|---|---|
| PubChem CID | 69284149 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-6-carbamoyl-3,5-dihydroxy-4-phenylmethoxyoxan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](C(N)=O)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C15H19NO7/c1-8(17)22-15-11(19)12(10(18)13(23-15)14(16)20)21-7-9-5-3-2-4-6-9/h2-6,10-13,15,18-19H,7H2,1H3,(H2,16,20)/t10-,11+,12-,13+,15-/m0/s1 |
| InChIKey | GVACZOCHGPGKLM-ARUSPNSKSA-N |
| XLogP | -0.93 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |