C11H24N2 — CID 69284863
2-cyclopentyl-1,1-di(propan-2-yl)hydrazine (PubChem CID 69284863) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 2-cyclopentyl-1,1-di(propan-2-yl)hydrazine.
| Compound Name | 2-cyclopentyl-1,1-di(propan-2-yl)hydrazine |
|---|---|
| PubChem CID | 69284863 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2-cyclopentyl-1,1-di(propan-2-yl)hydrazine |
| SMILES | CC(C)N(NC1CCCC1)C(C)C |
| InChI | InChI=1S/C11H24N2/c1-9(2)13(10(3)4)12-11-7-5-6-8-11/h9-12H,5-8H2,1-4H3 |
| InChIKey | HAHSANWDCXGADT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|