C14H16F2NO4P — CID 69284930
[(3S,8aS)-3-(2,5-difluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid (PubChem CID 69284930) has the molecular formula C14H16F2NO4P and a molecular weight of 331.26 g/mol. Its IUPAC name is [(3S,8aS)-3-(2,5-difluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid.
| Compound Name | [(3S,8aS)-3-(2,5-difluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid |
|---|---|
| PubChem CID | 69284930 |
| Molecular Formula | C14H16F2NO4P |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [(3S,8aS)-3-(2,5-difluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid |
| SMILES | O=C1C(P(=O)(O)O)CC[C@@H]2CC[C@@H](c3cc(F)ccc3F)N12 |
| InChI | InChI=1S/C14H16F2NO4P/c15-8-1-4-11(16)10(7-8)12-5-2-9-3-6-13(22(19,20)21)14(18)17(9)12/h1,4,7,9,12-13H,2-3,5-6H2,(H2,19,20,21)/t9-,12-,13?/m0/s1 |
| InChIKey | SUPPCXHMUOVNGN-PEJSQMDMSA-N |
| XLogP | 2.34 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|