About 3-aminooxolane-2,4-dione
3-aminooxolane-2,4-dione (PubChem CID 69284948) has the molecular formula C4H5NO3
and a molecular weight of 115.09 g/mol. Its IUPAC name is 3-aminooxolane-2,4-dione.
Molecular Properties
| Compound Name | 3-aminooxolane-2,4-dione |
| PubChem CID | 69284948 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 3-aminooxolane-2,4-dione |
| SMILES | NC1C(=O)COC1=O |
| InChI | InChI=1S/C4H5NO3/c5-3-2(6)1-8-4(3)7/h3H,1,5H2 |
| InChIKey | IAOMJFCJRDYKSX-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-aminooxolane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminooxolane-2,4-dione?
The IUPAC name of 3-aminooxolane-2,4-dione (CID 69284948) is 3-aminooxolane-2,4-dione.
What is the SMILES notation for 3-aminooxolane-2,4-dione?
The canonical SMILES for 3-aminooxolane-2,4-dione is NC1C(=O)COC1=O.
What is the InChIKey of 3-aminooxolane-2,4-dione?
The InChIKey is IAOMJFCJRDYKSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3/c5-3-2(6)1-8-4(3)7/h3H,1,5H2.
What are the key properties of 3-aminooxolane-2,4-dione?
3-aminooxolane-2,4-dione has a molecular weight of 115.09 g/mol, XLogP of -1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminooxolane-2,4-dione is sourced from PubChem (CID 69284948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).