About [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid
[(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid (PubChem CID 69285375) has the molecular formula C10H14F2NO4P
and a molecular weight of 281.19 g/mol. Its IUPAC name is [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid |
| PubChem CID | 69285375 |
| Molecular Formula | C10H14F2NO4P |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid |
| SMILES | O=C1C[C@H](C2C=CC(F)C(F)C2)NC1P(=O)(O)O |
| InChI | InChI=1S/C10H14F2NO4P/c11-6-2-1-5(3-7(6)12)8-4-9(14)10(13-8)18(15,16)17/h1-2,5-8,10,13H,3-4H2,(H2,15,16,17)/t5?,6?,7?,8-,10?/m1/s1 |
| InChIKey | RQMOGWZXQGJIGE-LXTPGUMNSA-N |
| XLogP | 0.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid?
The IUPAC name of [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid (CID 69285375) is [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid.
What is the SMILES notation for [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid?
The canonical SMILES for [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid is O=C1C[C@H](C2C=CC(F)C(F)C2)NC1P(=O)(O)O.
What is the InChIKey of [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid?
The InChIKey is RQMOGWZXQGJIGE-LXTPGUMNSA-N. The full InChI is InChI=1S/C10H14F2NO4P/c11-6-2-1-5(3-7(6)12)8-4-9(14)10(13-8)18(15,16)17/h1-2,5-8,10,13H,3-4H2,(H2,15,16,17)/t5?,6?,7?,8-,10?/m1/s1.
What are the key properties of [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid?
[(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid has a molecular weight of 281.19 g/mol, XLogP of 0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-5-(4,5-difluorocyclohex-2-en-1-yl)-3-oxopyrrolidin-2-yl]phosphonic acid is sourced from PubChem (CID 69285375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).