C15H18ClNO4P+ — CID 69286118
[(6S,9aR)-6-(4-chlorophenyl)-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 69286118) has the molecular formula C15H18ClNO4P+ and a molecular weight of 342.74 g/mol. Its IUPAC name is [(6S,9aR)-6-(4-chlorophenyl)-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(6S,9aR)-6-(4-chlorophenyl)-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 69286118 |
| Molecular Formula | C15H18ClNO4P+ |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [(6S,9aR)-6-(4-chlorophenyl)-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | O=C1C(O[P+](=O)O)CC[C@H]2CCC[C@@H](c3ccc(Cl)cc3)N12 |
| InChI | InChI=1S/C15H17ClNO4P/c16-11-6-4-10(5-7-11)13-3-1-2-12-8-9-14(21-22(19)20)15(18)17(12)13/h4-7,12-14H,1-3,8-9H2/p+1/t12-,13+,14?/m1/s1 |
| InChIKey | QMJLHEWMSZAASL-AMIUJLCOSA-O |
| XLogP | 3.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|