C22H38FN7O — CID 69286217
1-cyclopentyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane-2,4,6-triamine (PubChem CID 69286217) has the molecular formula C22H38FN7O and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane-2,4,6-triamine.
| Compound Name | 1-cyclopentyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane-2,4,6-triamine |
|---|---|
| PubChem CID | 69286217 |
| Molecular Formula | C22H38FN7O |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 1-cyclopentyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-5-(3-fluoro-4-methoxyphenyl)-1,3,5-triazinane-2,4,6-triamine |
| SMILES | CCN1CCCC1CN1C(N)N(c2ccc(OC)c(F)c2)C(N)N(C2CCCC2)C1N |
| InChI | InChI=1S/C22H38FN7O/c1-3-27-12-6-9-17(27)14-28-20(24)29(15-7-4-5-8-15)22(26)30(21(28)25)16-10-11-19(31-2)18(23)13-16/h10-11,13,15,17,20-22H,3-9,12,14,24-26H2,1-2H3 |
| InChIKey | VCPGYGNQXRPNMC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|