C24H33F4N7O — CID 69286438
6-N-(cyclohexylmethyl)-4-N-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-N-(1-pyrrolidin-2-ylpropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 69286438) has the molecular formula C24H33F4N7O and a molecular weight of 511.57 g/mol. Its IUPAC name is 6-N-(cyclohexylmethyl)-4-N-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-N-(1-pyrrolidin-2-ylpropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(cyclohexylmethyl)-4-N-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-N-(1-pyrrolidin-2-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 69286438 |
| Molecular Formula | C24H33F4N7O |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 6-N-(cyclohexylmethyl)-4-N-[3-fluoro-4-(trifluoromethoxy)phenyl]-2-N-(1-pyrrolidin-2-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCC(Nc1nc(NCC2CCCCC2)nc(Nc2ccc(OC(F)(F)F)c(F)c2)n1)C1CCCN1 |
| InChI | InChI=1S/C24H33F4N7O/c1-2-18(19-9-6-12-29-19)32-23-34-21(30-14-15-7-4-3-5-8-15)33-22(35-23)31-16-10-11-20(17(25)13-16)36-24(26,27)28/h10-11,13,15,18-19,29H,2-9,12,14H2,1H3,(H3,30,31,32,33,34,35) |
| InChIKey | DRWKDVIJBZMJAE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |