About 5-ethoxy-4H-furo[3,2-b]pyrrole
5-ethoxy-4H-furo[3,2-b]pyrrole (PubChem CID 69288103) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 5-ethoxy-4H-furo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 5-ethoxy-4H-furo[3,2-b]pyrrole |
| PubChem CID | 69288103 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-ethoxy-4H-furo[3,2-b]pyrrole |
| SMILES | CCOc1cc2occc2[nH]1 |
| InChI | InChI=1S/C8H9NO2/c1-2-10-8-5-7-6(9-8)3-4-11-7/h3-5,9H,2H2,1H3 |
| InChIKey | SYGUIFGUDUTHRR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethoxy-4H-furo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-4H-furo[3,2-b]pyrrole?
The IUPAC name of 5-ethoxy-4H-furo[3,2-b]pyrrole (CID 69288103) is 5-ethoxy-4H-furo[3,2-b]pyrrole.
What is the SMILES notation for 5-ethoxy-4H-furo[3,2-b]pyrrole?
The canonical SMILES for 5-ethoxy-4H-furo[3,2-b]pyrrole is CCOc1cc2occc2[nH]1.
What is the InChIKey of 5-ethoxy-4H-furo[3,2-b]pyrrole?
The InChIKey is SYGUIFGUDUTHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-2-10-8-5-7-6(9-8)3-4-11-7/h3-5,9H,2H2,1H3.
What are the key properties of 5-ethoxy-4H-furo[3,2-b]pyrrole?
5-ethoxy-4H-furo[3,2-b]pyrrole has a molecular weight of 151.16 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-4H-furo[3,2-b]pyrrole is sourced from PubChem (CID 69288103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).