About [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate
[4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate (PubChem CID 69288193) has the molecular formula C23H36NO6P
and a molecular weight of 453.52 g/mol. Its IUPAC name is [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate.
Molecular Properties
| Compound Name | [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate |
| PubChem CID | 69288193 |
| Molecular Formula | C23H36NO6P |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate |
| SMILES | CC(=O)c1ccc(CCC2(COP(=O)(OC(C)(C)C)OC(C)(C)C)COC(C)=N2)cc1 |
| InChI | InChI=1S/C23H36NO6P/c1-17(25)20-11-9-19(10-12-20)13-14-23(15-27-18(2)24-23)16-28-31(26,29-21(3,4)5)30-22(6,7)8/h9-12H,13-16H2,1-8H3 |
| InChIKey | BZLBIJDBLXBEPL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
The IUPAC name of [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate (CID 69288193) is [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate.
What is the SMILES notation for [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
The canonical SMILES for [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate is CC(=O)c1ccc(CCC2(COP(=O)(OC(C)(C)C)OC(C)(C)C)COC(C)=N2)cc1.
What is the InChIKey of [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
The InChIKey is BZLBIJDBLXBEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36NO6P/c1-17(25)20-11-9-19(10-12-20)13-14-23(15-27-18(2)24-23)16-28-31(26,29-21(3,4)5)30-22(6,7)8/h9-12H,13-16H2,1-8H3.
What are the key properties of [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
[4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate has a molecular weight of 453.52 g/mol, XLogP of 5.76, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate is sourced from PubChem (CID 69288193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).