About 2-methoxy-1H-furo[2,3-d]imidazole
2-methoxy-1H-furo[2,3-d]imidazole (PubChem CID 69288252) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 2-methoxy-1H-furo[2,3-d]imidazole.
Molecular Properties
| Compound Name | 2-methoxy-1H-furo[2,3-d]imidazole |
| PubChem CID | 69288252 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-methoxy-1H-furo[2,3-d]imidazole |
| SMILES | COc1nc2occc2[nH]1 |
| InChI | InChI=1S/C6H6N2O2/c1-9-6-7-4-2-3-10-5(4)8-6/h2-3H,1H3,(H,7,8) |
| InChIKey | ILDSOWFTIPZCHU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1H-furo[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1H-furo[2,3-d]imidazole?
The IUPAC name of 2-methoxy-1H-furo[2,3-d]imidazole (CID 69288252) is 2-methoxy-1H-furo[2,3-d]imidazole.
What is the SMILES notation for 2-methoxy-1H-furo[2,3-d]imidazole?
The canonical SMILES for 2-methoxy-1H-furo[2,3-d]imidazole is COc1nc2occc2[nH]1.
What is the InChIKey of 2-methoxy-1H-furo[2,3-d]imidazole?
The InChIKey is ILDSOWFTIPZCHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c1-9-6-7-4-2-3-10-5(4)8-6/h2-3H,1H3,(H,7,8).
What are the key properties of 2-methoxy-1H-furo[2,3-d]imidazole?
2-methoxy-1H-furo[2,3-d]imidazole has a molecular weight of 138.13 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1H-furo[2,3-d]imidazole is sourced from PubChem (CID 69288252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).