About (1-methylfuro[2,3-d]imidazol-2-yl)methanol
(1-methylfuro[2,3-d]imidazol-2-yl)methanol (PubChem CID 69288269) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is (1-methylfuro[2,3-d]imidazol-2-yl)methanol.
Molecular Properties
| Compound Name | (1-methylfuro[2,3-d]imidazol-2-yl)methanol |
| PubChem CID | 69288269 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (1-methylfuro[2,3-d]imidazol-2-yl)methanol |
| SMILES | Cn1c(CO)nc2occc21 |
| InChI | InChI=1S/C7H8N2O2/c1-9-5-2-3-11-7(5)8-6(9)4-10/h2-3,10H,4H2,1H3 |
| InChIKey | XRJIGOMFSUKHLG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylfuro[2,3-d]imidazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylfuro[2,3-d]imidazol-2-yl)methanol?
The IUPAC name of (1-methylfuro[2,3-d]imidazol-2-yl)methanol (CID 69288269) is (1-methylfuro[2,3-d]imidazol-2-yl)methanol.
What is the SMILES notation for (1-methylfuro[2,3-d]imidazol-2-yl)methanol?
The canonical SMILES for (1-methylfuro[2,3-d]imidazol-2-yl)methanol is Cn1c(CO)nc2occc21.
What is the InChIKey of (1-methylfuro[2,3-d]imidazol-2-yl)methanol?
The InChIKey is XRJIGOMFSUKHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-9-5-2-3-11-7(5)8-6(9)4-10/h2-3,10H,4H2,1H3.
What are the key properties of (1-methylfuro[2,3-d]imidazol-2-yl)methanol?
(1-methylfuro[2,3-d]imidazol-2-yl)methanol has a molecular weight of 152.15 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylfuro[2,3-d]imidazol-2-yl)methanol is sourced from PubChem (CID 69288269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).