About 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one
6-amino-3H-furo[2,3-d][1,3]oxazol-2-one (PubChem CID 69288301) has the molecular formula C5H4N2O3
and a molecular weight of 140.10 g/mol. Its IUPAC name is 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one.
Molecular Properties
| Compound Name | 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one |
| PubChem CID | 69288301 |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one |
| SMILES | Nc1coc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C5H4N2O3/c6-2-1-9-4-3(2)10-5(8)7-4/h1H,6H2,(H,7,8) |
| InChIKey | HSRZFAKMHAOZDK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one?
The IUPAC name of 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one (CID 69288301) is 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one.
What is the SMILES notation for 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one?
The canonical SMILES for 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one is Nc1coc2[nH]c(=O)oc12.
What is the InChIKey of 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one?
The InChIKey is HSRZFAKMHAOZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3/c6-2-1-9-4-3(2)10-5(8)7-4/h1H,6H2,(H,7,8).
What are the key properties of 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one?
6-amino-3H-furo[2,3-d][1,3]oxazol-2-one has a molecular weight of 140.10 g/mol, XLogP of 0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3H-furo[2,3-d][1,3]oxazol-2-one is sourced from PubChem (CID 69288301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).