About 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine
2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine (PubChem CID 69288321) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine |
| PubChem CID | 69288321 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine |
| SMILES | CCNc1nc2oc(N)cc2[nH]1 |
| InChI | InChI=1S/C7H10N4O/c1-2-9-7-10-4-3-5(8)12-6(4)11-7/h3H,2,8H2,1H3,(H2,9,10,11) |
| InChIKey | CIWKXQLFSSLPTB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine?
The IUPAC name of 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine (CID 69288321) is 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine.
What is the SMILES notation for 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine?
The canonical SMILES for 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine is CCNc1nc2oc(N)cc2[nH]1.
What is the InChIKey of 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine?
The InChIKey is CIWKXQLFSSLPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-2-9-7-10-4-3-5(8)12-6(4)11-7/h3H,2,8H2,1H3,(H2,9,10,11).
What are the key properties of 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine?
2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine has a molecular weight of 166.18 g/mol, XLogP of 1.17, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-1H-furo[2,3-d]imidazole-2,5-diamine is sourced from PubChem (CID 69288321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).