About 1-ethylfuro[2,3-d]imidazole-2,5-diamine
1-ethylfuro[2,3-d]imidazole-2,5-diamine (PubChem CID 69288322) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-ethylfuro[2,3-d]imidazole-2,5-diamine.
Molecular Properties
| Compound Name | 1-ethylfuro[2,3-d]imidazole-2,5-diamine |
| PubChem CID | 69288322 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-ethylfuro[2,3-d]imidazole-2,5-diamine |
| SMILES | CCn1c(N)nc2oc(N)cc21 |
| InChI | InChI=1S/C7H10N4O/c1-2-11-4-3-5(8)12-6(4)10-7(11)9/h3H,2,8H2,1H3,(H2,9,10) |
| InChIKey | IUTRHDPISMWMQN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethylfuro[2,3-d]imidazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylfuro[2,3-d]imidazole-2,5-diamine?
The IUPAC name of 1-ethylfuro[2,3-d]imidazole-2,5-diamine (CID 69288322) is 1-ethylfuro[2,3-d]imidazole-2,5-diamine.
What is the SMILES notation for 1-ethylfuro[2,3-d]imidazole-2,5-diamine?
The canonical SMILES for 1-ethylfuro[2,3-d]imidazole-2,5-diamine is CCn1c(N)nc2oc(N)cc21.
What is the InChIKey of 1-ethylfuro[2,3-d]imidazole-2,5-diamine?
The InChIKey is IUTRHDPISMWMQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-2-11-4-3-5(8)12-6(4)10-7(11)9/h3H,2,8H2,1H3,(H2,9,10).
What are the key properties of 1-ethylfuro[2,3-d]imidazole-2,5-diamine?
1-ethylfuro[2,3-d]imidazole-2,5-diamine has a molecular weight of 166.18 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylfuro[2,3-d]imidazole-2,5-diamine is sourced from PubChem (CID 69288322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).